CAS 83798-15-6

2-(3,5-dimethylphenoxy)acetohydrazide

Description:

2-(3,5-Dimethylphenoxy)acetohydrazide is an organic compound characterized by its hydrazide functional group and a phenoxy moiety. It features a 3,5-dimethyl-substituted phenyl ring, which contributes to its hydrophobic characteristics and potential biological activity. The presence of the acetohydrazide group suggests that it may participate in various chemical reactions, including hydrazone formation and potential interactions with biological targets. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic structure, while its hydrazide functionality may impart some polar characteristics. The compound's structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as hydrazides are often explored for their antimicrobial and anti-inflammatory properties. Additionally, the specific arrangement of substituents can influence its reactivity and interaction with other molecules, making it a subject of interest in synthetic organic chemistry and drug design. As with any chemical substance, safety and handling precautions should be observed, particularly due to the potential reactivity of hydrazides.

Formula: C₁₀H₁₄N₂O₂

InChI: InChI=1/C10H14N2O2/c1-7-3-8(2)5-9(4-7)14-6-10(13)12-11/h3-5H,6,11H2,1-2H3,(H,12,13)

SMILES: Cc1cc(C)cc(c1)OCC(=NN)O

Synonyms:

• (3,5-Dimethyl-phenoxy)-acetic acid hydrazide
• Acetic Acid, 2-(3,5-Dimethylphenoxy)-, Hydrazide