CAS 838-22-2
:(4-methoxyphenyl)(4-methylphenyl)methanol
Description:
(4-methoxyphenyl)(4-methylphenyl)methanol, with the CAS number 838-22-2, is an organic compound characterized by its structure, which features a methanol group attached to a carbon atom that is further bonded to two aromatic rings: one containing a methoxy group and the other a methyl group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It exhibits moderate solubility in organic solvents such as ethanol and ether, while being less soluble in water due to its hydrophobic aromatic rings. The presence of the methoxy and methyl substituents can influence its chemical reactivity and physical properties, such as boiling and melting points. Additionally, this compound may exhibit interesting biological activities, making it of interest in various fields, including pharmaceuticals and materials science. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C15H16O2
InChI:InChI=1/C15H16O2/c1-11-3-5-12(6-4-11)15(16)13-7-9-14(17-2)10-8-13/h3-10,15-16H,1-2H3
Synonyms:- Benzenemethanol, alpha-(4-methoxyphenyl)-4-methyl-
- (4-Methoxyphenyl)(4-methylphenyl)methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.