CAS 83800-45-7
:2,5-dioxopyrrolidin-1-yl N-(pentafluorobenzoyl)-L-methionylglycinate
Description:
2,5-Dioxopyrrolidin-1-yl N-(pentafluorobenzoyl)-L-methionylglycinate, with the CAS number 83800-45-7, is a synthetic compound that features a complex structure characterized by a pyrrolidine ring with two carbonyl groups (dioxo) and an amino acid derivative. This compound includes a pentafluorobenzoyl moiety, which contributes to its unique chemical properties, particularly in terms of reactivity and stability. The presence of multiple fluorine atoms enhances its lipophilicity and may influence its biological activity. The methionylglycinate portion indicates that it is a derivative of the amino acid methionine, which is essential for protein synthesis and has various roles in metabolism. The compound's structure suggests potential applications in pharmaceuticals, particularly in drug design and development, due to its ability to interact with biological targets. Its stability, solubility, and reactivity can be influenced by the surrounding environment, making it a subject of interest in medicinal chemistry and related fields.
Formula:C18H16F5N3O6S
InChI:InChI=1/C18H16F5N3O6S/c1-33-5-4-7(17(30)24-6-10(29)32-26-8(27)2-3-9(26)28)25-18(31)11-12(19)14(21)16(23)15(22)13(11)20/h7H,2-6H2,1H3,(H,24,30)(H,25,31)/t7-/m0/s1
SMILES:CSCC[C@@H](C(=NCC(=O)ON1C(=O)CCC1=O)O)N=C(c1c(c(c(c(c1F)F)F)F)F)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.