CymitQuimica logo

CAS 83802-71-5

:

5-fluoro-6-methoxy-2,3-dihydro-1H-inden-1-one

Description:
5-Fluoro-6-methoxy-2,3-dihydro-1H-inden-1-one is an organic compound characterized by its unique bicyclic structure, which includes an indene core modified by a fluorine atom and a methoxy group. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The methoxy group contributes to the compound's overall polarity and can affect its solubility in various solvents. This compound may exhibit interesting reactivity due to the presence of the carbonyl group in the indanone structure, which can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Additionally, the dihydro configuration indicates that the compound has two hydrogen atoms added to the double bond of the indene, which can affect its stability and reactivity. Overall, 5-fluoro-6-methoxy-2,3-dihydro-1H-inden-1-one is a compound of interest for further research, particularly in the fields of pharmaceuticals and organic synthesis.
Formula:C10H9FO2
InChI:InChI=1/C10H9FO2/c1-13-10-5-7-6(4-8(10)11)2-3-9(7)12/h4-5H,2-3H2,1H3
InChI key:FFZRFPIFJVKURP-UHFFFAOYSA-N
SMILES:COc1cc2c(CCC2=O)cc1F
Found 4 products.