CAS 83803-82-1
:4-(Chloromethyl)-N-(1-methylethyl)benzamide
Description:
4-(Chloromethyl)-N-(1-methylethyl)benzamide, identified by its CAS number 83803-82-1, is an organic compound characterized by its aromatic structure and functional groups. It features a benzamide backbone, which consists of a benzene ring attached to a carbonyl group (amide) and a chloromethyl substituent. The presence of the chloromethyl group introduces reactivity, making it a potential intermediate in organic synthesis. The N-(1-methylethyl) moiety indicates that there is an isopropyl group attached to the nitrogen atom of the amide, contributing to the compound's steric and electronic properties. This compound may exhibit moderate solubility in organic solvents and is likely to participate in nucleophilic substitution reactions due to the electrophilic nature of the chloromethyl group. Its applications could span various fields, including pharmaceuticals and agrochemicals, where it may serve as a building block for more complex molecules. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental concerns.
Formula:C11H14ClNO
InChI:InChI=1S/C11H14ClNO/c1-8(2)13-11(14)10-5-3-9(7-12)4-6-10/h3-6,8H,7H2,1-2H3,(H,13,14)
InChI key:InChIKey=RPFIHLIZZKXZAY-UHFFFAOYSA-N
SMILES:C(NC(C)C)(=O)C1=CC=C(CCl)C=C1
Synonyms:- 4-(chloromethyl)-N-(1-methylethyl)benzamide
- Benzamide, 4-(chloromethyl)-N-(1-methylethyl)-
- 4-(Chloromethyl)-N-(isopropyl)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.