
CAS 83803-94-5
:2-Naphthalenecarboxylic acid, 2-(2-methylbenzoyl)hydrazide
Description:
2-Naphthalenecarboxylic acid, 2-(2-methylbenzoyl)hydrazide, also known by its CAS number 83803-94-5, is an organic compound characterized by its hydrazide functional group attached to a naphthalene derivative. This compound typically exhibits properties associated with both aromatic and hydrazide functionalities, which may include moderate solubility in organic solvents and limited solubility in water. The presence of the naphthalene ring contributes to its stability and potential for π-π stacking interactions, which can influence its behavior in various chemical environments. Additionally, the hydrazide group can participate in hydrogen bonding, making it relevant in biological and pharmaceutical applications. The compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of more complex molecules. Its structural features suggest it could be of interest in fields such as medicinal chemistry, materials science, and organic synthesis. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly.
Formula:C19H16N2O2
InChI:InChI=1S/C19H16N2O2/c1-13-6-2-5-9-17(13)19(23)21-20-18(22)16-11-10-14-7-3-4-8-15(14)12-16/h2-12H,1H3,(H,20,22)(H,21,23)
InChI key:InChIKey=PLZLECZNFLCRPC-UHFFFAOYSA-N
SMILES:C(NNC(=O)C1=C(C)C=CC=C1)(=O)C2=CC3=C(C=C2)C=CC=C3
Synonyms:- 2-(2-Naphthoyl)-1-(o-toluoyl)hydrazine
- NSC 88892
- 2-Naphthalenecarboxylic acid, 2-(2-methylbenzoyl)hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
