CAS 83803-95-6
:2-Naphthalenecarboxylic acid, 2-(4-methylbenzoyl)hydrazide
Description:
2-Naphthalenecarboxylic acid, 2-(4-methylbenzoyl)hydrazide, also known by its CAS number 83803-95-6, is an organic compound characterized by its hydrazide functional group attached to a naphthalene ring system. This compound typically exhibits properties associated with both aromatic and hydrazide functionalities, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of the naphthalene moiety contributes to its aromaticity, which can influence its reactivity and interaction with other chemical species. Additionally, the 4-methylbenzoyl group may impart specific steric and electronic effects, potentially affecting the compound's biological activity and reactivity. Such compounds are often of interest in medicinal chemistry and materials science due to their potential applications in drug development and as intermediates in organic synthesis. The compound's melting point, boiling point, and specific reactivity would depend on its molecular structure and the conditions under which it is studied. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C19H16N2O2
InChI:InChI=1/C19H16N2O2/c1-13-6-8-15(9-7-13)18(22)20-21-19(23)17-11-10-14-4-2-3-5-16(14)12-17/h2-12H,1H3,(H,20,22)(H,21,23)
InChI key:InChIKey=MZJUACPKDPRXTP-UHFFFAOYSA-N
SMILES:C(NNC(=O)C1=CC=C(C)C=C1)(=O)C2=CC3=C(C=C2)C=CC=C3
Synonyms:- 2-Naphthalenecarboxylic acid, 2-(4-methylbenzoyl)hydrazide
- N'-(4-methylbenzoyl)naphthalene-2-carbohydrazide
- NSC 88894
- Naphthoylptoluoylhydrazine
- 4-Methyl-N'-[(naphthalen-2-yl)carbonyl]benzohydrazide
- N'-(4-Methylbenzoyl)-2-naphthohydrazide
- 1-(4-METHYLBENZOYL)-2-(2-NAPHTHOYL)HYDRAZINE
- N'-(4-Methylbenzoyl)-2-naphthalenecarbohydrazide
- 2-(2-NAPHTHOYL)-1-(P-TOLUOYL)HYDRAZINE
- 2'-(4-methylbenzoyl)-2-naphthohydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
