CAS 83808-22-4

2-Methyl-1-piperidinepropanamide

Description:

2-Methyl-1-piperidinepropanamide, identified by its CAS number 83808-22-4, is an organic compound characterized by its amide functional group and a piperidine ring. This compound features a piperidine moiety, which is a six-membered ring containing one nitrogen atom, and is substituted with a methyl group and a propanamide chain. The presence of the amide group contributes to its potential as a polar molecule, influencing its solubility and reactivity. Typically, compounds like this may exhibit moderate to high boiling points due to hydrogen bonding capabilities associated with the amide functional group. The structure suggests potential applications in pharmaceuticals or as intermediates in organic synthesis, given the piperidine's role in medicinal chemistry. Additionally, the compound's characteristics, such as its melting point, boiling point, and specific reactivity, would depend on its molecular interactions and the surrounding environment. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.

Formula: C₉H₁₈N₂O

InChI: InChI=1S/C9H18N2O/c1-8-4-2-3-6-11(8)7-5-9(10)12/h8H,2-7H2,1H3,(H2,10,12)

InChI key: InChIKey=BUAQVWZRXIZFFG-UHFFFAOYSA-N

SMILES: C(CC(N)=O)N1C(C)CCCC1

Synonyms:

• 1-Piperidinepropanamide, 2-methyl-
• 2-Methyl-1-piperidinepropanamide