CAS 83810-94-0

4-(4-Formylcyclohexyl)benzonitrile

Description:

4-(4-Formylcyclohexyl)benzonitrile, with the CAS number 83810-94-0, is an organic compound characterized by its structural features, which include a benzonitrile moiety and a cyclohexyl group with a formyl substituent. This compound typically exhibits properties associated with aromatic nitriles, such as moderate solubility in organic solvents and potential reactivity due to the presence of both the nitrile and aldehyde functional groups. The presence of the formyl group suggests that it can participate in various chemical reactions, including condensation and nucleophilic addition. Additionally, the cyclohexyl ring may influence the compound's steric and electronic properties, potentially affecting its reactivity and interactions with other molecules. The compound's applications may extend to fields such as materials science, organic synthesis, and pharmaceuticals, where its unique structure can be leveraged for specific chemical transformations or as a building block in more complex molecules. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₄H₁₅NO

InChI: InChI=1S/C14H15NO/c15-9-11-1-5-13(6-2-11)14-7-3-12(10-16)4-8-14/h1-2,5-6,10,12,14H,3-4,7-8H2

InChI key: InChIKey=FIQRFWBYVFIOPU-UHFFFAOYSA-N

SMILES: C(#N)C1=CC=C(C=C1)C2CCC(C=O)CC2

Synonyms:

• Benzonitrile, 4-(4-formylcyclohexyl)-
• 4-(4-Formylcyclohexyl)benzonitrile