CAS 83811-83-0
:Quinoline, 1,2,3,4-tetrahydro-6-methoxy-, hydrochloride (1:1)
Description:
Quinoline, 1,2,3,4-tetrahydro-6-methoxy-, hydrochloride (1:1), with the CAS number 83811-83-0, is a chemical compound that belongs to the class of tetrahydroquinolines, which are bicyclic compounds derived from quinoline. This substance features a methoxy group at the 6-position of the quinoline ring, contributing to its unique chemical properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and facilitates its use in various applications, including pharmaceuticals. The compound may exhibit biological activity, making it of interest in medicinal chemistry for potential therapeutic uses. Its structure suggests that it may participate in various chemical reactions typical of nitrogen-containing heterocycles, such as electrophilic substitutions or nucleophilic attacks. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound represents a significant area of study within organic and medicinal chemistry due to its structural characteristics and potential applications.
Formula:C10H13NO·ClH
InChI:InChI=1S/C10H13NO.ClH/c1-12-9-4-5-10-8(7-9)3-2-6-11-10;/h4-5,7,11H,2-3,6H2,1H3;1H
InChI key:InChIKey=PUNAIBGBPJOJLT-UHFFFAOYSA-N
SMILES:O(C)C=1C=C2C(=CC1)NCCC2.Cl
Synonyms:- 6-methoxy-1,2,3,4-tetrahydroquinolinium chloride
- Quinoline, 1,2,3,4-tetrahydro-6-methoxy-, hydrochloride
- Quinoline, 1,2,3,4-tetrahydro-6-methoxy-, hydrochloride (1:1)
- 6-Methoxy-1,2,3,4-tetrahydroquinoline hydrochloride
- 1,2,3,4-Tetrahydro-6-methoxyquinolinium chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
