CAS 83816-54-0

2-Hydroxy-3-(1-methylpropyl)benzaldehyde

Description:

2-Hydroxy-3-(1-methylpropyl)benzaldehyde, also known as p-cresol derivative, is an organic compound characterized by its aromatic structure featuring a hydroxyl group and an aldehyde functional group. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents and exhibits limited solubility in water due to its hydrophobic alkyl chain. The presence of the hydroxyl group contributes to its reactivity, allowing it to participate in hydrogen bonding, which can influence its boiling and melting points. This compound is often used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Proper storage conditions are essential to maintain its stability and prevent degradation.

Formula: C₁₁H₁₄O₂

InChI: InChI=1S/C11H14O2/c1-3-8(2)10-6-4-5-9(7-12)11(10)13/h4-8,13H,3H2,1-2H3

InChI key: InChIKey=HQVNCBQLJJGAOO-UHFFFAOYSA-N

SMILES: C(CC)(C)C1=C(O)C(C=O)=CC=C1

Synonyms:

• 2-Hydroxy-3-(1-methylpropyl)benzaldehyde
• Benzaldehyde, 2-hydroxy-3-(1-methylpropyl)-