CAS 83822-34-8
:2-Amino-4,5,6,7-tetrahydro-N-(3-methylphenyl)benzo[b]thiophene-3-carboxamide
Description:
2-Amino-4,5,6,7-tetrahydro-N-(3-methylphenyl)benzo[b]thiophene-3-carboxamide, with the CAS number 83822-34-8, is a chemical compound characterized by its complex structure, which includes a benzo[b]thiophene core fused with a tetrahydro group and an amide functional group. This compound features an amino group and a carboxamide, contributing to its potential as a bioactive molecule. It is likely to exhibit properties such as solubility in organic solvents, and its molecular structure suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The presence of the 3-methylphenyl substituent may influence its pharmacological activity and lipophilicity. Additionally, the compound's stereochemistry and functional groups can affect its reactivity and stability under various conditions. While specific applications or biological activities may vary, compounds of this nature are often explored for their potential therapeutic effects in various fields, including neuropharmacology and cancer research.
Formula:C16H18N2OS
InChI:InChI=1S/C16H18N2OS/c1-10-5-4-6-11(9-10)18-16(19)14-12-7-2-3-8-13(12)20-15(14)17/h4-6,9H,2-3,7-8,17H2,1H3,(H,18,19)
InChI key:InChIKey=REZVJXLAYIAXCQ-UHFFFAOYSA-N
SMILES:C(NC1=CC(C)=CC=C1)(=O)C=2C3=C(SC2N)CCCC3
Synonyms:- 2-Amino-4,5,6,7-tetrahydro-benzo[b]thiophene-3-carboxylic acid m-tolylamide
- Benzo[b]thiophene-3-carboxamide, 2-amino-4,5,6,7-tetrahydro-N-(3-methylphenyl)-
- 2-Amino-N-(3-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
- 2-Amino-4,5,6,7-tetrahydro-N-(3-methylphenyl)benzo[b]thiophene-3-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.