CAS 83823-07-8
:6,8-Dichloro-2H-1-benzopyran-3-carboxylic acid
Description:
6,8-Dichloro-2H-1-benzopyran-3-carboxylic acid is a chemical compound characterized by its unique structure, which includes a benzopyran ring system substituted with two chlorine atoms at the 6 and 8 positions and a carboxylic acid functional group at the 3 position. This compound is typically a solid at room temperature and is soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the benzopyran moiety. The presence of chlorine atoms introduces significant electronegativity, which can influence the compound's reactivity and potential biological activity. The carboxylic acid group contributes to its acidity and can participate in various chemical reactions, such as esterification or amidation. This compound may be of interest in pharmaceutical research and development due to its potential biological properties, including antimicrobial or anti-inflammatory activities. As with many chemical substances, proper handling and safety precautions are essential, given the potential hazards associated with chlorine-containing compounds.
Formula:C10H6Cl2O3
InChI:InChI=1S/C10H6Cl2O3/c11-7-2-5-1-6(10(13)14)4-15-9(5)8(12)3-7/h1-3H,4H2,(H,13,14)
InChI key:InChIKey=UYWUAFUTOZDQED-UHFFFAOYSA-N
SMILES:ClC1=C2C(C=C(C(O)=O)CO2)=CC(Cl)=C1
Synonyms:- 6,8-Dichloro-2H-1-benzopyran-3-carboxylic acid
- 2H-1-Benzopyran-3-carboxylic acid, 6,8-dichloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
