
CAS 83824-93-5
:O-Cyclohexyl-L-serine
Description:
O-Cyclohexyl-L-serine is an amino acid derivative characterized by the presence of a cyclohexyl group attached to the oxygen atom of the hydroxyl group in L-serine. This modification can influence its solubility, stability, and biological activity compared to standard L-serine. The compound typically exhibits properties associated with amino acids, such as the ability to participate in peptide bond formation and act as a building block for proteins. Its cyclohexyl substitution may enhance hydrophobic interactions, potentially affecting its interactions with enzymes or receptors. O-Cyclohexyl-L-serine may also exhibit unique pharmacological properties, making it of interest in medicinal chemistry and drug design. The compound is likely to be soluble in organic solvents and may have limited solubility in water, depending on the specific conditions. As with many amino acid derivatives, it may be used in various biochemical applications, including studies of protein structure and function, as well as in the development of novel therapeutic agents.
Formula:C9H17NO3
InChI:InChI=1S/C9H17NO3/c10-8(9(11)12)6-13-7-4-2-1-3-5-7/h7-8H,1-6,10H2,(H,11,12)/t8-/m0/s1
InChI key:InChIKey=VCCHBJSBZQMJEF-QMMMGPOBSA-N
SMILES:O(C[C@@H](C(O)=O)N)C1CCCCC1
Synonyms:- O-Cyclohexyl-L-serine
- (2S)-2-Amino-3-(cyclohexyloxy)propanoic acid
- L-Serine, O-cyclohexyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.