
CAS 83833-17-4
:1-Naphthalenecarboxylic acid, 2-(4-methoxybenzoyl)hydrazide
Description:
1-Naphthalenecarboxylic acid, 2-(4-methoxybenzoyl)hydrazide, identified by its CAS number 83833-17-4, is an organic compound characterized by its hydrazide functional group and aromatic structure. This compound features a naphthalene ring system, which contributes to its stability and potential for π-π stacking interactions. The presence of the 4-methoxybenzoyl moiety enhances its solubility in organic solvents and may influence its reactivity and biological activity. Typically, compounds of this nature exhibit properties such as moderate to high melting points and may be soluble in polar organic solvents. They can participate in various chemical reactions, including hydrazone formation and potential applications in medicinal chemistry due to their ability to interact with biological targets. Additionally, the methoxy group can provide electron-donating effects, potentially affecting the compound's reactivity and interaction with other molecules. Overall, this compound's unique structure suggests potential utility in pharmaceuticals or as a building block in organic synthesis.
Formula:C19H16N2O3
InChI:InChI=1S/C19H16N2O3/c1-24-15-11-9-14(10-12-15)18(22)20-21-19(23)17-8-4-6-13-5-2-3-7-16(13)17/h2-12H,1H3,(H,20,22)(H,21,23)
InChI key:InChIKey=MTZHJEBRPLTJNT-UHFFFAOYSA-N
SMILES:C(NNC(=O)C1=CC=C(OC)C=C1)(=O)C=2C3=C(C=CC2)C=CC=C3
Synonyms:- 2′-(4-Methoxybenzoyl)-1-naphthohydrazide
- NSC 88898
- 1-Naphthalenecarboxylic acid, 2-(4-methoxybenzoyl)hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.