CAS 83833-29-8

α-Cyclopropyl-2,4-dimethylbenzenemethanol

Description:

α-Cyclopropyl-2,4-dimethylbenzenemethanol, with the CAS number 83833-29-8, is an organic compound characterized by its unique structure that includes a cyclopropyl group and a benzyl alcohol moiety. This compound features a cyclopropyl ring, which is a three-membered carbon ring known for its strain and reactivity, attached to a benzene ring that has two methyl substituents at the 2 and 4 positions. The presence of the hydroxyl (-OH) group in the benzyl alcohol structure contributes to its potential as a solvent and reagent in organic synthesis. The compound may exhibit interesting chemical properties, such as varying solubility in polar and nonpolar solvents, and it could participate in various chemical reactions, including nucleophilic substitutions and oxidation. Additionally, the steric hindrance introduced by the cyclopropyl and methyl groups may influence its reactivity and interaction with biological systems. Overall, α-Cyclopropyl-2,4-dimethylbenzenemethanol is a compound of interest in both synthetic organic chemistry and potential applications in pharmaceuticals.

Formula: C₁₂H₁₆O

InChI: InChI=1S/C12H16O/c1-8-3-6-11(9(2)7-8)12(13)10-4-5-10/h3,6-7,10,12-13H,4-5H2,1-2H3

InChI key: InChIKey=OWFYESAAHVXGKO-UHFFFAOYSA-N

SMILES: C(O)(C1=C(C)C=C(C)C=C1)C2CC2

Synonyms:

• Benzenemethanol, α-cyclopropyl-2,4-dimethyl-
• α-Cyclopropyl-2,4-dimethylbenzenemethanol