CAS 83843-39-4

N~1~-(2,6-dimethylphenyl)-N~2~,N~2~-dimethylpropane-1,2-diamine dihydrochloride

Description:

N~1~-(2,6-dimethylphenyl)-N~2~,N~2~-dimethylpropane-1,2-diamine dihydrochloride, commonly referred to by its CAS number 83843-39-4, is a chemical compound that belongs to the class of aliphatic amines. This substance features a central propane backbone with two amine functional groups, which contribute to its basicity and potential reactivity. The presence of the 2,6-dimethylphenyl group enhances its lipophilicity, potentially influencing its solubility and interaction with biological systems. As a dihydrochloride salt, it is typically more stable and soluble in aqueous environments compared to its free base form. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or pathways. Safety and handling precautions should be observed, as with many amines, due to potential irritant properties. Overall, its unique structure and functional groups suggest a range of applications in both industrial and research settings.

Formula: C₁₃H₂₄Cl₂N₂

InChI: InChI=1/C13H22N2.2ClH/c1-10-7-6-8-11(2)13(10)14-9-12(3)15(4)5;;/h6-8,12,14H,9H2,1-5H3;2*1H

SMILES: Cc1cccc(C)c1NCC(C)N(C)C.Cl.Cl

GYKI-23107 HCl

CAS: 83843-39-4

GYKI-23107 is an antiarrhythmic agent with a local anesthetic activity.

Formula: C₁₃H₂₄Cl₂N₂

Color and Shape: Solid

Molecular weight: 279.25

Ref: TM-T32032