CAS 83843-49-6

N~1~-(2,6-dimethylphenyl)-N~2~,N~2~-dimethylpropane-1,2-diamine

Description:

N~1~-(2,6-dimethylphenyl)-N~2~,N~2~-dimethylpropane-1,2-diamine, with CAS number 83843-49-6, is an organic compound characterized by its amine functional groups. It features a central propane backbone with two amine groups attached to the first and second carbon atoms, contributing to its basicity and potential reactivity. The presence of the 2,6-dimethylphenyl group enhances its hydrophobic character, which may influence its solubility in organic solvents rather than in water. This compound is likely to exhibit properties typical of secondary and tertiary amines, such as nucleophilicity and the ability to form hydrogen bonds. Its structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, where amine functionalities are often crucial. Additionally, the steric hindrance introduced by the dimethyl groups may affect its reactivity and interaction with other chemical species. Safety data and handling precautions should be considered, as amines can be irritants and may pose health risks if not managed properly.

Formula: C₁₃H₂₂N₂

InChI: InChI=1/C13H22N2/c1-10-7-6-8-11(2)13(10)14-9-12(3)15(4)5/h6-8,12,14H,9H2,1-5H3

SMILES: Cc1cccc(C)c1NCC(C)N(C)C

Synonyms:

• 1-(2,6-Dimethylphenylamino)-2-dimethylaminopropane
• 1,2-Propanediamine, N1-(2,6-dimethylphenyl)-N2,N2-dimethyl-

N-[2-(Dimethylamino)propyl]-2,6-dimethylaniline

CAS: 83843-49-6

Versatile small molecule scaffold

Formula: C₁₃H₂₂N₂

Purity: Min. 95%

Molecular weight: 206.33 g/mol

Ref: 3D-IDA84349