CAS 83844-25-1

2-Butenoic acid, 4-(2,4-difluorophenyl)-4-oxo-

Description:

2-Butenoic acid, 4-(2,4-difluorophenyl)-4-oxo-, also known by its CAS number 83844-25-1, is an organic compound characterized by its unique structure that includes a butenoic acid moiety and a difluorophenyl group. This compound features a double bond in the butenoic acid portion, which contributes to its reactivity and potential applications in organic synthesis. The presence of the 2,4-difluorophenyl substituent introduces significant electronegative fluorine atoms, which can influence the compound's polarity, solubility, and overall chemical behavior. Typically, such compounds may exhibit interesting biological activities, making them of interest in pharmaceutical research. The presence of the keto group (4-oxo) further enhances its reactivity, allowing for various chemical transformations. Overall, 2-Butenoic acid, 4-(2,4-difluorophenyl)-4-oxo- is a versatile compound with potential applications in medicinal chemistry and materials science, although specific properties such as melting point, boiling point, and solubility would need to be referenced from detailed chemical databases or literature for precise information.

Formula: C₁₀H₆F₂O₃

InChI: InChI=1S/C10H6F2O3/c11-6-1-2-7(8(12)5-6)9(13)3-4-10(14)15/h1-5H,(H,14,15)

InChI key: InChIKey=GYTCEHNGUPAFMD-UHFFFAOYSA-N

SMILES: C(C=CC(O)=O)(=O)C1=C(F)C=C(F)C=C1

Synonyms:

• 4-(2,4-Difluorophenyl)-4-oxo-2-butenoic acid
• 2-Butenoic acid, 4-(2,4-difluorophenyl)-4-oxo-