CAS 83846-62-2
:Methyl 1-phenyl-1H-imidazole-5-carboxylate
Description:
Methyl 1-phenyl-1H-imidazole-5-carboxylate, with the CAS number 83846-62-2, is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a methyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of the phenyl group enhances its aromatic characteristics, potentially influencing its electronic properties and interactions with other molecules. Methyl 1-phenyl-1H-imidazole-5-carboxylate is typically a white to off-white solid, and it may exhibit moderate stability under standard conditions. Its applications may include use in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, owing to the imidazole moiety's biological significance. The compound's properties, such as melting point, boiling point, and solubility, can vary based on purity and environmental conditions, making it essential to consult specific literature for detailed information regarding its behavior in various chemical contexts.
Formula:C11H10N2O2
InChI:InChI=1S/C11H10N2O2/c1-15-11(14)10-7-12-8-13(10)9-5-3-2-4-6-9/h2-8H,1H3
InChI key:InChIKey=CKWUTWFZMPGKGM-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1N(C=NC1)C2=CC=CC=C2
Synonyms:- NSC 97020
- 1H-Imidazole-5-carboxylic acid, 1-phenyl-, methyl ester
- Methyl 1-phenyl-1H-imidazole-5-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
