CAS 83846-78-0

(3,4-Diaminophenyl)-2-thienylmethanone

Description:

(3,4-Diaminophenyl)-2-thienylmethanone, identified by its CAS number 83846-78-0, is an organic compound characterized by its unique structure, which includes a phenyl ring with two amino groups at the 3 and 4 positions, and a thienyl group attached to a carbonyl moiety. This compound typically exhibits properties associated with both aromatic amines and thienyl derivatives, such as potential solubility in polar organic solvents and moderate stability under standard conditions. The presence of amino groups suggests it may participate in hydrogen bonding and could act as a ligand in coordination chemistry. Additionally, the thienyl moiety may impart specific electronic properties, influencing its reactivity and potential applications in organic synthesis or as a pharmaceutical intermediate. Its biological activity, if any, would depend on the specific interactions facilitated by its functional groups. Overall, (3,4-Diaminophenyl)-2-thienylmethanone is of interest in various fields, including medicinal chemistry and materials science, due to its structural features and potential reactivity.

Formula: C₁₁H₁₀N₂OS

InChI: InChI=1S/C11H10N2OS/c12-8-4-3-7(6-9(8)13)11(14)10-2-1-5-15-10/h1-6H,12-13H2

InChI key: InChIKey=OVVRQDDFAJNUGP-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(N)=C(N)C=C1)C2=CC=CS2

Synonyms:

• (3,4-Diamino-phenyl)-thiophen-2-yl-methanone
• (3,4-Diaminophenyl)(Thiophen-2-Yl)Methanone
• (3,4-Diaminophenyl)-2-thienylmethanone
• (3,4-Diaminophenyl)-thiophen-2-ylmethanone
• 4-Thenoyl-1,2-phenylenediamine
• Methanone, (3,4-diaminophenyl)-2-thienyl-
• (3,4-Diaminophenyl) (2-thienyl) ketone