
CAS 83846-84-8
:2-Methyl 3-carboxy-1-methyl-1H-pyrrole-2-acetate
Description:
2-Methyl 3-carboxy-1-methyl-1H-pyrrole-2-acetate, with the CAS number 83846-84-8, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a carboxylic acid group and an acetate moiety, contributing to its reactivity and potential applications in organic synthesis. The presence of methyl groups at specific positions on the pyrrole ring influences its electronic properties and steric hindrance, which can affect its reactivity and interactions with other molecules. Typically, such compounds may exhibit biological activity, making them of interest in medicinal chemistry and drug development. Additionally, the functional groups present in 2-Methyl 3-carboxy-1-methyl-1H-pyrrole-2-acetate can participate in various chemical reactions, including esterification and nucleophilic substitutions. Its solubility and stability in different solvents can vary, which is important for its practical applications in laboratory settings. Overall, this compound represents a unique structure with potential utility in various chemical and pharmaceutical contexts.
Formula:C9H11NO4
InChI:InChI=1S/C9H11NO4/c1-10-4-3-6(9(12)13)7(10)5-8(11)14-2/h3-4H,5H2,1-2H3,(H,12,13)
InChI key:InChIKey=BMNWMCNTXMXNRT-UHFFFAOYSA-N
SMILES:C(C(OC)=O)C1=C(C(O)=O)C=CN1C
Synonyms:- 2-Methyl 3-carboxy-1-methyl-1H-pyrrole-2-acetate
- 1H-Pyrrole-2-acetic acid, 3-carboxy-1-methyl-, α-methyl ester
- 1H-Pyrrole-2-acetic acid, 3-carboxy-1-methyl-, 2-methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.