CAS 83846-92-8
:Choline dihydrogen phosphate
Description:
Choline dihydrogen phosphate, with the CAS number 83846-92-8, is an organic compound that serves as a source of choline, an essential nutrient involved in various biological processes. This substance is characterized by its phosphate group, which contributes to its solubility in water and its role in cellular signaling and metabolism. Choline dihydrogen phosphate is typically a white crystalline solid and is stable under standard conditions. It is often used in biochemical research and as a dietary supplement due to its potential benefits for cognitive function and liver health. The compound is also involved in the synthesis of phospholipids, which are crucial components of cell membranes. Additionally, it may play a role in the regulation of neurotransmitters, further highlighting its importance in neurobiology. As with many phosphates, it is important to handle choline dihydrogen phosphate with care, as it can be reactive under certain conditions. Overall, its unique properties make it a valuable compound in both scientific and nutritional contexts.
Formula:C5H14NO·H2O4P
InChI:InChI=1S/C5H14NO.H3O4P/c1-6(2,3)4-5-7;1-5(2,3)4/h7H,4-5H2,1-3H3;(H3,1,2,3,4)/q+1;/p-1
InChI key:InChIKey=LPPJNZJBKFSQGA-UHFFFAOYSA-M
SMILES:P(=O)([O-])(O)O.C([N+](C)(C)C)CO
Synonyms:- 2-Hydroxy-N,N,N-trimethylethanaminium dihydrogenphosphate
- 2-Hydroxyethyl-Trimethyl-Ammonium Phosphate
- 2-hydroxy-N,N,N-trimethylethanaminium dihydrogen phosphate
- Choline phosphate
- Cholinium dihydrogen phosphate
- Ethanaminium, 2-hydroxy-N,N,N-trimethyl-, phosphate (1:1)
- Ethanaminium, 2-hydroxy-N,N,N-trimethyl-, phosphate (1:1) (salt)
- Choline dihydrogen phosphate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Hydroxy-N,N,N-trimethylethanaminium dihydrogenphosphate
CAS:Formula:C5H16NO5PMolecular weight:201.1580
