
CAS 83846-94-0
:4-Propylphenyl 4-heptylbenzoate
Description:
4-Propylphenyl 4-heptylbenzoate, with the CAS number 83846-94-0, is an organic compound that belongs to the class of benzoates, which are esters derived from benzoic acid. This substance features a propyl group attached to a phenyl ring and a heptyl group linked to another phenyl ring through an ester bond. Its molecular structure contributes to its characteristics, including moderate to high lipophilicity, which can influence its solubility in organic solvents. The compound may exhibit unique thermal and optical properties, making it of interest in applications such as liquid crystal displays or as a plasticizer in polymer formulations. Additionally, its molecular weight and specific functional groups can affect its reactivity and interactions with other chemical species. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 4-Propylphenyl 4-heptylbenzoate is a specialized compound with potential applications in various fields of chemistry and materials science.
Formula:C23H30O2
InChI:InChI=1S/C23H30O2/c1-3-5-6-7-8-10-20-11-15-21(16-12-20)23(24)25-22-17-13-19(9-4-2)14-18-22/h11-18H,3-10H2,1-2H3
InChI key:InChIKey=OUSRURSEKXEDCJ-UHFFFAOYSA-N
SMILES:O(C(=O)C1=CC=C(CCCCCCC)C=C1)C2=CC=C(CCC)C=C2
Synonyms:- 4-Propylphenyl 4-heptylbenzoate
- Me 73
- Benzoic acid, 4-heptyl-, 4-propylphenyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.