CAS 83847-90-9

2-Chloro-3-methoxy-4-(phenylmethoxy)benzaldehyde

Description:

2-Chloro-3-methoxy-4-(phenylmethoxy)benzaldehyde, with the CAS number 83847-90-9, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features a chloro substituent at the second position, a methoxy group at the third position, and a phenylmethoxy group at the fourth position of the benzene ring. The presence of these substituents contributes to its unique chemical properties, such as potential reactivity in electrophilic aromatic substitution reactions and its ability to participate in various organic synthesis pathways. The methoxy groups enhance its solubility in organic solvents, while the chloro group can serve as a leaving group in nucleophilic substitution reactions. Additionally, the compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its physical properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods, as they can vary based on purity and environmental conditions.

Formula: C₁₅H₁₃ClO₃

InChI: InChI=1S/C15H13ClO3/c1-18-15-13(8-7-12(9-17)14(15)16)19-10-11-5-3-2-4-6-11/h2-9H,10H2,1H3

InChI key: InChIKey=ZTNWKHUIHQVLAK-UHFFFAOYSA-N

SMILES: O(C)C1=C(OCC2=CC=CC=C2)C=CC(C=O)=C1Cl

Synonyms:

• 2-Chloro-3-methoxy-4-(phenylmethoxy)benzaldehyde
• m-Anisaldehyde, 4-(benzyloxy)-2-chloro-
• Benzaldehyde, 2-chloro-3-methoxy-4-(phenylmethoxy)-
• 4-Benzyloxy-2-chloro-3-methoxybenzaldehyde