CAS 83860-32-6
:Cyclopropanecarboxylicacid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (R)-cyano(3-phenoxyphenyl)methylester, (1S,3R)-
Description:
Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (R)-cyano(3-phenoxyphenyl)methyl ester, with CAS number 83860-32-6, is a complex organic compound characterized by its unique structural features. It contains a cyclopropane ring, which contributes to its rigidity and strain, influencing its reactivity and stability. The presence of a carboxylic acid functional group indicates potential acidity and reactivity in various chemical reactions. The dichloroethenyl substituent introduces halogen atoms, which can enhance biological activity and influence solubility. Additionally, the cyano group and phenoxyphenyl moiety suggest potential applications in agrochemicals or pharmaceuticals, as these groups are often associated with bioactivity. The stereochemistry indicated by the (R) and (1S,3R) descriptors suggests specific spatial arrangements that can affect the compound's interactions with biological targets. Overall, this compound's unique combination of functional groups and stereochemistry makes it of interest in synthetic chemistry and potential applications in various fields.
Formula:C22H19Cl2NO3
InChI:InChI=1S/C22H19Cl2NO3/c1-22(2)17(12-19(23)24)20(22)21(26)28-18(13-25)14-7-6-10-16(11-14)27-15-8-4-3-5-9-15/h3-12,17-18,20H,1-2H3/t17-,18-,20+/m0/s1
InChI key:InChIKey=KAATUXNTWXVJKI-CMKODMSKSA-N
SMILES:C(O[C@@H](C#N)C1=CC(OC2=CC=CC=C2)=CC=C1)(=O)[C@H]3[C@H](C=C(Cl)Cl)C3(C)C
Synonyms:- (-)-Theta-Cypermethrin
- Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (R)-cyano(3-phenoxyphenyl)methyl ester, (1S,3R)-
- Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, cyano(3-phenoxyphenyl)methyl ester, [1S-[1α(S*),3β]]-
- Cyclopropanecarboxylicacid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, cyano(3-phenoxyphenyl)methylester, [1S-[1a(S*),3b]]-
- Ru 27997
- Ru27997
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(1S,2R,1'R)-Cypermethrin
CAS:Controlled ProductFormula:C22H19Cl2NO3Color and Shape:NeatMolecular weight:416.297
