CymitQuimica logo

CAS 83863-73-4

:

1-Piperidinecarboxylic acid, 3,4,4-trimethoxy-, ethyl ester

Description:
1-Piperidinecarboxylic acid, 3,4,4-trimethoxy-, ethyl ester, with CAS number 83863-73-4, is an organic compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group that is esterified with ethyl alcohol, resulting in an ethyl ester. The presence of three methoxy groups at the 3, 4, and 4 positions of the aromatic system contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The methoxy groups can also influence the compound's reactivity and solubility in various solvents. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the presence of the piperidine moiety suggests potential applications in the synthesis of pharmaceuticals or agrochemicals. As with many organic compounds, safety data and handling precautions should be considered, as they may vary based on the specific use and concentration of the substance.
Formula:C11H21NO5
InChI:InChI=1S/C11H21NO5/c1-5-17-10(13)12-7-6-11(15-3,16-4)9(8-12)14-2/h9H,5-8H2,1-4H3
InChI key:InChIKey=IRFADAQNHJWEIN-UHFFFAOYSA-N
SMILES:O(C)C1(OC)C(OC)CN(C(OCC)=O)CC1
Synonyms:
  • 1-Piperidinecarboxylic acid, 3,4,4-trimethoxy-, ethyl ester
  • Ethyl 3,4,4-trimethoxypiperidine-1-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.