CAS 83863-76-7
:Decanoic acid, 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]-4-piperidinyl ester, hydrochloride (1:1)
Description:
Decanoic acid, 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]-4-piperidinyl ester, hydrochloride (1:1), with CAS number 83863-76-7, is a synthetic compound characterized by its complex structure, which includes a decanoic acid moiety linked to a piperidine derivative. This compound typically exhibits properties associated with both lipophilicity and hydrophilicity due to the presence of long-chain fatty acid and aromatic groups. The hydrochloride form indicates that it is a salt, which often enhances its solubility in water and stability. The presence of halogen substituents, such as chlorine and fluorine, can influence its biological activity and pharmacokinetic properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological targets. Its specific applications and effects would depend on further studies, including its mechanism of action, toxicity, and efficacy in relevant biological systems.
Formula:C31H41ClFNO3·ClH
InChI:InChI=1S/C31H41ClFNO3.ClH/c1-2-3-4-5-6-7-8-11-30(36)37-31(26-14-16-27(32)17-15-26)20-23-34(24-21-31)22-9-10-29(35)25-12-18-28(33)19-13-25;/h12-19H,2-11,20-24H2,1H3;1H
InChI key:InChIKey=SLUOSCSHTFTUDS-UHFFFAOYSA-N
SMILES:O(C(CCCCCCCCC)=O)C1(CCN(CCCC(=O)C2=CC=C(F)C=C2)CC1)C3=CC=C(Cl)C=C3.Cl
Synonyms:- 4-(4-Chlorophenyl)-1-[4-(4-Fluorophenyl)-4-Oxobutyl]Piperidin-4-Yl Decanoate Hydrochloride
- Decanoic acid, 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]-4-piperidinyl ester, hydrochloride
- Decanoic acid, 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]-4-piperidinyl ester, hydrochloride (1:1)
- 4-(4-Chlorophenyl)-1-(4-(4-fluorophenyl)-4-oxobutyl)-4-piperidyl decanoate hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Haloperidol Decanoate HCl
CAS:Formula:C31H41ClFNO3·HClColor and Shape:White To Off-White SolidMolecular weight:530.12 36.46
