
CAS 83863-77-8
:6-(2-Chloroethyl)-3,7-dimethyl-5H-thiazolo[3,2-a]pyrimidin-5-one
Description:
6-(2-Chloroethyl)-3,7-dimethyl-5H-thiazolo[3,2-a]pyrimidin-5-one is a heterocyclic compound characterized by its thiazolo and pyrimidinone structures. This compound features a thiazole ring fused to a pyrimidine, which contributes to its unique chemical properties. The presence of a chloroethyl group enhances its reactivity, potentially allowing for various substitution reactions. The methyl groups at positions 3 and 7 of the thiazolo ring influence its steric and electronic properties, which can affect its biological activity and solubility. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 6-(2-Chloroethyl)-3,7-dimethyl-5H-thiazolo[3,2-a]pyrimidin-5-one represents a class of compounds that may have significant implications in drug development and chemical research.
Formula:C10H11ClN2OS
InChI:InChI=1S/C10H11ClN2OS/c1-6-5-15-10-12-7(2)8(3-4-11)9(14)13(6)10/h5H,3-4H2,1-2H3
InChI key:InChIKey=MGWXSWNURQSQHA-UHFFFAOYSA-N
SMILES:O=C1N2C(=NC(C)=C1CCCl)SC=C2C
Synonyms:- 5H-Thiazolo[3,2-a]pyrimidin-5-one, 6-(2-chloroethyl)-3,7-dimethyl-
- 6-(2-Chloroethyl)-3,7-dimethyl-5H-thiazolo[3,2-a]pyrimidin-5-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.