CAS 83863-79-0

Florifenine

Description:

Florifenine, with the CAS number 83863-79-0, is a chemical compound that belongs to the class of phenylpyridines. It is primarily recognized for its application in the field of agriculture, particularly as a herbicide. The compound exhibits selective herbicidal activity, targeting specific weed species while minimizing harm to desirable crops. Florifenine functions by inhibiting certain biochemical pathways in plants, leading to growth disruption and eventual plant death. Its effectiveness is influenced by factors such as application rate, environmental conditions, and the specific weed species present. Additionally, Florifenine's chemical stability and solubility characteristics play a crucial role in its formulation and efficacy in agricultural practices. As with many agrochemicals, safety and environmental impact assessments are essential to ensure responsible use and minimize potential risks to non-target organisms and ecosystems. Overall, Florifenine represents a valuable tool in modern agricultural practices, contributing to effective weed management strategies.

Formula: C₂₃H₂₂F₃N₃O₂

InChI: InChI=1/C23H22F3N3O2/c24-23(25,26)16-7-8-17-20(9-10-27-21(17)15-16)28-19-6-2-1-5-18(19)22(30)31-14-13-29-11-3-4-12-29/h1-2,5-10,15H,3-4,11-14H2,(H,27,28)

SMILES: c1ccc(c(c1)C(=O)OCCN1CCCC1)Nc1ccnc2cc(ccc12)C(F)(F)F

Synonyms:

• Florifenine [INN]
• 2-(1-Pyrrolidinyl)ethyl N-(7-(trifluoromethyl)-4-quinolyl)anthranilate
• Unii-S7Ut8Vqg94
• 2-(Pyrrolidin-1-Yl)Ethyl 2-{[7-(Trifluoromethyl)Quinolin-4-Yl]Amino}Benzoate

Florifenine

CAS: 83863-79-0

Florifenine is a low potency inhibitor of oxidative phosphorylation. It has been shown to inhibit the activity of fatty acid synthase, which is an enzyme that catalyzes the synthesis of fatty acids. Florifenine has been shown to reduce the levels of PGE2 in mice with hyperproliferative disease, demonstrating its potential as a therapeutic agent for this type of cancer. Florifenine also inhibits tumor growth by stimulating repair mechanisms, such as cellular mitosis and DNA synthesis.

Formula: C₂₃H₂₂F₃N₃O₂

Purity: Min. 95%

Color and Shape: Clear Liquid

Molecular weight: 429.44 g/mol

Ref: 3D-FF23311