CAS 83878-01-7
:3,3-Dichloro-2,2-dihydroxycyclohexanone
Description:
3,3-Dichloro-2,2-dihydroxycyclohexanone is an organic compound characterized by its cyclohexanone structure, which features two hydroxyl (-OH) groups and two chlorine atoms attached to the cyclohexane ring. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of hydroxyl groups, which can engage in hydrogen bonding. The dichloro substitution indicates that chlorine atoms are located at the 3-position of the cyclohexanone ring, which can influence the compound's reactivity and stability. The presence of hydroxyl groups suggests potential applications in various chemical reactions, including as intermediates in organic synthesis or as potential agents in medicinal chemistry. Additionally, the compound's unique structure may impart specific biological activities, making it of interest in pharmacological research. Safety data should be consulted, as halogenated compounds can exhibit toxicity or environmental persistence. Overall, 3,3-Dichloro-2,2-dihydroxycyclohexanone is a compound of interest in both synthetic and applied chemistry contexts.
Formula:C6H8Cl2O3
InChI:InChI=1S/C6H8Cl2O3/c7-5(8)3-1-2-4(9)6(5,10)11/h10-11H,1-3H2
InChI key:InChIKey=CMFHEHLGXLKUKA-UHFFFAOYSA-N
SMILES:OC1(O)C(Cl)(Cl)CCCC1=O
Synonyms:- 3,3-Dichloro-2,2-dihydroxycyclohexan-1-one
- Cyclohexanone, 3,3-dichloro-2,2-dihydroxy-
- 3,3-Dichloro-2,2-dihydroxycyclohexanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.