CymitQuimica logo

CAS 83880-70-0

:

Dexamethasone acefurate

Description:
Dexamethasone acefurate is a synthetic corticosteroid with anti-inflammatory and immunosuppressive properties. It is a prodrug of dexamethasone, meaning it is converted into the active form in the body. This compound is characterized by its ability to modulate the immune response and reduce inflammation, making it useful in various therapeutic applications, particularly in treating conditions such as allergies, autoimmune disorders, and certain types of cancer. Dexamethasone acefurate is typically administered in a form that allows for enhanced absorption and bioavailability compared to its parent compound. Its mechanism of action involves binding to glucocorticoid receptors, leading to the regulation of gene expression and subsequent effects on cellular processes. The substance is generally well-tolerated, but like other corticosteroids, it may have side effects, especially with long-term use, including potential impacts on metabolism, immune function, and endocrine balance. As with any medication, its use should be guided by a healthcare professional, considering the specific clinical context and patient needs.
Formula:C29H33FO8
InChI:InChI=1S/C29H33FO8/c1-16-12-21-20-8-7-18-13-19(32)9-10-26(18,3)28(20,30)23(33)14-27(21,4)29(16,24(34)15-37-17(2)31)38-25(35)22-6-5-11-36-22/h5-6,9-11,13,16,20-21,23,33H,7-8,12,14-15H2,1-4H3/t16-,20+,21+,23+,26+,27+,28+,29+/m1/s1
InChI key:InChIKey=DDIWRLSEGOVQQD-BJRLRHTOSA-N
SMILES:O(C(=O)C1=CC=CO1)[C@@]2(C(COC(C)=O)=O)[C@]3(C)[C@@](C[C@H]2C)([C@]4([C@](F)([C@@H](O)C3)[C@]5(C)C(CC4)=CC(=O)C=C5)[H])[H]
Synonyms:
  • Dexamethasone acefurate
  • Pregna-1,4-diene-3,20-dione, 21-(acetyloxy)-9-fluoro-17-[(2-furanylcarbonyl)oxy]-11-hydroxy-16-methyl-, (11β,16α)-
  • (11β,16α)-21-(Acetyloxy)-9-fluoro-17-[(2-furanylcarbonyl)oxy]-11-hydroxy-16-methylpregna-1,4-diene-3,20-dione
  • Sch 31353
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.