CAS 838820-86-3

6-Nitro-1-[4-(trifluoromethyl)phenyl]-1H-indazole

Description:

6-Nitro-1-[4-(trifluoromethyl)phenyl]-1H-indazole is a synthetic organic compound characterized by its complex structure, which includes an indazole core substituted with a nitro group and a trifluoromethylphenyl moiety. The presence of the nitro group typically imparts polar characteristics, enhancing its solubility in polar solvents. The trifluoromethyl group contributes to the compound's lipophilicity and can influence its biological activity, often enhancing the potency of pharmaceuticals. This compound is of interest in medicinal chemistry and may exhibit various biological activities, including potential applications in drug development. Its molecular structure suggests it may participate in various chemical reactions, such as electrophilic substitutions, due to the electron-withdrawing nature of the nitro and trifluoromethyl groups. Additionally, the compound's stability and reactivity can be influenced by the presence of these substituents, making it a subject of study in both synthetic and medicinal chemistry contexts. Safety and handling precautions should be observed due to the potential toxicity associated with nitro compounds.

Formula: C₁₄H₈F₃N₃O₂

InChI: InChI=1S/C14H8F3N3O2/c15-14(16,17)10-2-5-11(6-3-10)19-13-7-12(20(21)22)4-1-9(13)8-18-19/h1-8H

InChI key: InChIKey=AAOIITKTFBBIDO-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=C2N(N=CC2=CC1)C3=CC=C(C(F)(F)F)C=C3

Synonyms:

• 1H-Indazole, 6-nitro-1-[4-(trifluoromethyl)phenyl]-
• 6-Nitro-1-[4-(trifluoromethyl)phenyl]-1H-indazole

6-Nitro-1-(4-(trifluoromethyl)phenyl)-1H-indazole

CAS: 838820-86-3

Formula: C₁₄H₈F₃N₃O₂

Molecular weight: 307.2274

Ref: IN-DA00G3BQ