CAS 838850-72-9

2-(2-oxobenzo[cd]indol-1(2H)-yl)propanoic acid

Description:

2-(2-Oxobenzo[cd]indol-1(2H)-yl)propanoic acid, with the CAS number 838850-72-9, is a chemical compound that features a complex structure characterized by an indole moiety fused with a benzene ring and a propanoic acid functional group. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, which may influence its solubility, reactivity, and potential biological activity. The presence of the oxo group contributes to its reactivity, potentially allowing for interactions with various biological targets. Such compounds are often studied for their pharmacological properties, including anti-inflammatory and anticancer activities. The specific stereochemistry and substituents can significantly affect its behavior in biological systems, making it a subject of interest in medicinal chemistry. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function, highlighting the importance of detailed characterization in the development of therapeutic agents.

Formula: C₁₄H₁₁NO₃

InChI: InChI=1/C14H11NO3/c1-8(14(17)18)15-11-7-3-5-9-4-2-6-10(12(9)11)13(15)16/h2-8H,1H3,(H,17,18)

SMILES: CC(C(=O)O)n1c2cccc3cccc(c23)c1=O

2-(2-oxobenzo[cd]indol-1(2H)-yl)propanoic acid

CAS: 838850-72-9

Purity: 95.0%

Molecular weight: 241.24600219726562

Ref: 10-F315633