CymitQuimica logo

CAS 83890-23-7

:

1,1-dimethyl-2,5,8,11,14,17,20-heptaoxa-1-silacycloicosane

Description:
1,1-Dimethyl-2,5,8,11,14,17,20-heptaoxa-1-silacycloicosane, with CAS number 83890-23-7, is a silacycloalkane characterized by its unique structure that incorporates both silicon and oxygen atoms within a cyclic framework. This compound features a silacycloicosane core, which consists of a 20-membered ring, and is substituted with seven ether-like oxygen atoms, contributing to its distinctive chemical properties. The presence of the dimethyl groups enhances its steric bulk and may influence its reactivity and solubility. Generally, compounds of this nature exhibit interesting thermal and chemical stability due to the silicon-oxygen bonds, which can impart unique properties such as increased resistance to hydrolysis compared to traditional organic compounds. Additionally, the cyclic structure may lead to interesting conformational dynamics and potential applications in materials science, particularly in the development of polymers or as precursors in silicon-based materials. Overall, this compound represents a fascinating intersection of organic and inorganic chemistry, showcasing the versatility of silicon in synthetic applications.
Formula:C14H30O7Si
InChI:InChI=1/C14H30O7Si/c1-22(2)20-13-11-18-9-7-16-5-3-15-4-6-17-8-10-19-12-14-21-22/h3-14H2,1-2H3
SMILES:C[Si]1(C)OCCOCCOCCOCCOCCOCCO1
Synonyms:
  • Dimethylsila-20-crown-7
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.