CymitQuimica logo

CAS 83890-24-8

:

Vinylmethylsila-14-crown-5

Description:
Vinylmethylsila-14-crown-5 is a specialized chemical compound that belongs to the class of crown ethers, which are cyclic compounds known for their ability to selectively bind cations. This particular compound features a siloxane group and a vinylmethyl substituent, which enhances its reactivity and solubility in organic solvents. The crown ether structure allows it to form complexes with various metal ions, making it useful in applications such as ion-selective electrodes, extraction processes, and as a ligand in coordination chemistry. Its unique properties stem from the combination of the crown ether's cavity size and the presence of the vinylmethyl group, which can participate in further chemical reactions, such as polymerization. Vinylmethylsila-14-crown-5 is typically characterized by its molecular weight, solubility in organic solvents, and its ability to form stable complexes with specific cations. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance.
Formula:C11H22O5Si
InChI:InChI=1S/C11H22O5Si/c1-3-17(2)15-10-8-13-6-4-12-5-7-14-9-11-16-17/h3H,1,4-11H2,2H3
InChI key:InChIKey=YXPLVLLJQLMERC-UHFFFAOYSA-N
SMILES:C(=C)[Si]1(C)OCCOCCOCCOCCO1
Synonyms:
  • 2-Ethenyl-2-methyl-1,3,6,9,12-pentaoxa-2-silacyclotetradecane
  • 1,3,6,9,12-Pentaoxa-2-silacyclotetradecane, 2-ethenyl-2-methyl-
  • Vinylmethylsila-14-crown-5
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.