CymitQuimica logo

CAS 83898-17-3

:

N′-(2-Hydroxyphenyl)-N,N-dimethylurea

Description:
N′-(2-Hydroxyphenyl)-N,N-dimethylurea, also known as dimethylurea derivative, is an organic compound characterized by its urea functional group, which is substituted with a 2-hydroxyphenyl group and two methyl groups. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydroxyl group that enhances its solubility. It exhibits properties associated with both urea and phenolic compounds, which may contribute to its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the hydroxyl group can also impart certain biological activities, making it of interest in medicinal chemistry. Additionally, its structure allows for potential interactions with biological targets, which may lead to various pharmacological effects. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact may vary based on concentration and exposure.
Formula:C9H12N2O2
InChI:InChI=1S/C9H12N2O2/c1-11(2)9(13)10-7-5-3-4-6-8(7)12/h3-6,12H,1-2H3,(H,10,13)
InChI key:InChIKey=VYKYSTWKUAETPR-UHFFFAOYSA-N
SMILES:N(C(N(C)C)=O)C1=C(O)C=CC=C1
Synonyms:
  • 3-(2-Hydroxyphenyl)-1,1-dimethylurea
  • Urea, N′-(2-hydroxyphenyl)-N,N-dimethyl-
  • N′-(2-Hydroxyphenyl)-N,N-dimethylurea
  • Urea, 3-(o-hydroxyphenyl)-1,1-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.