CAS 83898-32-2
:2-Phenyl-2-[1-(phenylmethyl)-4-piperidinyl]pentanedinitrile
Description:
2-Phenyl-2-[1-(phenylmethyl)-4-piperidinyl]pentanedinitrile, with the CAS number 83898-32-2, is a chemical compound characterized by its complex structure, which includes a pentanedinitrile backbone substituted with phenyl and piperidine groups. This compound typically exhibits properties associated with nitriles, such as high polarity and potential solubility in organic solvents. The presence of the piperidine ring suggests that it may exhibit basic properties, which can influence its reactivity and interaction with biological systems. Additionally, the phenyl groups contribute to its aromatic characteristics, potentially affecting its stability and reactivity. Such compounds may be of interest in medicinal chemistry due to their structural features, which could lead to biological activity. However, specific data regarding its melting point, boiling point, and other physical properties would require experimental determination or literature reference. Overall, the unique combination of functional groups in this compound suggests potential applications in pharmaceuticals or as intermediates in organic synthesis.
Formula:C23H25N3
InChI:InChI=1S/C23H25N3/c24-15-7-14-23(19-25,21-10-5-2-6-11-21)22-12-16-26(17-13-22)18-20-8-3-1-4-9-20/h1-6,8-11,22H,7,12-14,16-18H2
InChI key:InChIKey=DYAREKOTPJQVFN-UHFFFAOYSA-N
SMILES:C(CCC#N)(C#N)(C1CCN(CC2=CC=CC=C2)CC1)C3=CC=CC=C3
Synonyms:- 2-(1-benzylpiperidin-4-yl)-2-phenylpentanedinitrile
- Pentanedinitrile, 2-phenyl-2-[1-(phenylmethyl)-4-piperidinyl]-
- 2-Phenyl-2-[1-(phenylmethyl)-4-piperidinyl]pentanedinitrile
- 2-(1-Benzyl-4-piperidyl)-2-phenylglutaronitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.