CAS 83901-40-0
:4-[2-oxo-2-({phenyl[2-(piperidin-1-yl)phenyl]methyl}amino)ethyl]benzoic acid
Description:
4-[2-oxo-2-({phenyl[2-(piperidin-1-yl)phenyl]methyl}amino)ethyl]benzoic acid, with the CAS number 83901-40-0, is a synthetic organic compound characterized by its complex structure, which includes a benzoic acid moiety and a piperidine ring. This compound features a phenyl group attached to a piperidine, indicating potential biological activity, possibly as a pharmaceutical agent. The presence of the ketone functional group (2-oxo) suggests reactivity that could be exploited in various chemical reactions. The carboxylic acid group in the benzoic acid portion contributes to its acidity and solubility properties, which may influence its interaction with biological systems. Additionally, the compound's structure implies potential applications in medicinal chemistry, particularly in the development of drugs targeting specific receptors or enzymes. Its unique combination of functional groups may also provide opportunities for further derivatization, enhancing its pharmacological profile. Overall, this compound exemplifies the intricate design often found in drug development, balancing structural complexity with potential therapeutic efficacy.
Formula:C27H28N2O3
InChI:InChI=1/C27H28N2O3/c30-25(19-20-13-15-22(16-14-20)27(31)32)28-26(21-9-3-1-4-10-21)23-11-5-6-12-24(23)29-17-7-2-8-18-29/h1,3-6,9-16,26H,2,7-8,17-19H2,(H,28,30)(H,31,32)
Synonyms:- benzoic acid, 4-[2-oxo-2-[[phenyl[2-(1-piperidinyl)phenyl]methyl]amino]ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
AZ-DF 265
CAS:AZ-DF 265: hypoglycemic, stimulates insulin, inhibits ATP-sensitive K+ channels, displaces [3H]-glibenclamide.Formula:C27H28N2O3Color and Shape:SolidMolecular weight:428.52
