
CAS 83903-06-4
:Lupitidine
Description:
Lupitidine, with the CAS number 83903-06-4, is a chemical compound that belongs to the class of piperidine derivatives. It is primarily recognized for its potential pharmacological applications, particularly in the field of medicinal chemistry. The compound exhibits properties that may influence neurotransmitter systems, making it of interest in research related to neurological disorders. Lupitidine is characterized by its specific molecular structure, which includes a piperidine ring, contributing to its biological activity. The compound is typically studied for its effects on various receptors and enzymes, and it may possess anti-inflammatory or analgesic properties. As with many chemical substances, its safety profile, including toxicity and side effects, is an important consideration in its development and application. Research on lupitidine is ongoing, and its full therapeutic potential is still being explored in various scientific studies.
Formula:C21H27N5O2S
InChI:InChI=1S/C21H27N5O2S/c1-15-4-5-16(11-23-15)10-17-12-24-21(25-20(17)27)22-8-9-29-14-19-7-6-18(28-19)13-26(2)3/h4-7,11-12H,8-10,13-14H2,1-3H3,(H2,22,24,25,27)
InChI key:InChIKey=IKEHSFKMCULMKJ-UHFFFAOYSA-N
SMILES:C(C=1C(=O)NC(NCCSCC=2OC(CN(C)C)=CC2)=NC1)C=3C=CC(C)=NC3
Synonyms:- 4(1H)-Pyrimidinone, 2-[[2-[[[5-[(dimethylamino)methyl]-2-furanyl]methyl]thio]ethyl]amino]-5-[(6-methyl-3-pyridinyl)methyl]-
- CM 10 (pharmaceutical)
- Lupitidine
- 2-[[2-[[[5-[(Dimethylamino)methyl]-2-furanyl]methyl]thio]ethyl]amino]-5-[(6-methyl-3-pyridinyl)methyl]-4(1H)-pyrimidinone
- CM 10
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lupitidine
CAS:Lupitidine is a bioactive chemical.Formula:C21H27N5O2SColor and Shape:SolidMolecular weight:413.54
