CAS 83907-40-8
:6-methoxy-1-(3-sulfopropyl)chinolinium monohydrate
Description:
6-Methoxy-1-(3-sulfopropyl)quinolinium monohydrate is a chemical compound characterized by its unique structure, which includes a quinolinium core substituted with a methoxy group and a sulfopropyl group. This compound typically appears as a solid, often in crystalline form, and is soluble in water due to the presence of the sulfonic acid group, which enhances its hydrophilicity. The monohydrate form indicates that it contains one molecule of water per molecule of the compound, which can influence its physical properties, such as solubility and stability. The presence of the methoxy group can affect its electronic properties and reactivity, making it potentially useful in various applications, including as a fluorescent probe or in biological studies. Additionally, the sulfonic acid group contributes to its ionic character, which may play a role in its interaction with biological systems or other chemical species. Overall, this compound's unique functional groups and structure make it of interest in both research and potential industrial applications.
Formula:C13H15NO4S
InChI:InChI=1/C13H15NO4S/c1-18-12-5-6-13-11(10-12)4-2-7-14(13)8-3-9-19(15,16)17/h2,4-7,10H,3,8-9H2,1H3
SMILES:COc1ccc2c(ccc[n+]2CCC[S-](=O)(=O)=O)c1
Synonyms:- 6-Methoxy-N-(3-Sulfopropyl) Quinolinium
- 3-(6-Methoxy-1-quinolinio)propanesulfonate inner salt monohydrate
- 3-(6-Methoxyquinolinium-1-Yl)Propane-1-Sulfonate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Quinolinium,6-methoxy-1-(3-sulfopropyl)-, inner salt
CAS:Formula:C13H15NO4SPurity:97%Color and Shape:SolidMolecular weight:281.3275SPQ
CAS:SPQ is used to measure membrane chloride transport mechanisms.Formula:C13H15NO4SPurity:99.42%Color and Shape:SolidMolecular weight:281.336-Methoxy-N-(3-sulfopropyl)quinolinium
CAS:Controlled Product<p>Applications SPQ offers a simple and yet powerful method to examine and measure membrane chloride transport mechanisms.<br>References Tanford, C., et al.: J. Phys. Chem., 76, 3020 (1972,) Verkman, A., et al.: Anal. Biochem., 178, 355 (1989), Danino, D., et al.: Science, 269, 1420 (1995), Rodriguez, A., et al.: Langmuir, 19, 7206 (2003),<br></p>Formula:C13H15NO4SColor and Shape:NeatMolecular weight:281.33





