CymitQuimica logo

CAS 83909-22-2

:

4,4"-Dibromo-1,1':3',1"-terphenyl

Description:
4,4'-Dibromo-1,1':3',1"-terphenyl is an organic compound characterized by its structure, which consists of three phenyl rings connected by a central biphenyl unit, with bromine substituents at the para positions of the outer phenyl rings. This compound is typically a solid at room temperature and exhibits a high melting point due to its rigid structure. It is known for its stability and resistance to thermal degradation, making it suitable for various applications in materials science and organic electronics. The presence of bromine atoms enhances its electronic properties, potentially making it useful in the development of organic semiconductors or as a building block in organic synthesis. Additionally, 4,4'-Dibromo-1,1':3',1"-terphenyl may exhibit interesting photophysical properties, which can be exploited in optoelectronic devices. However, handling this compound requires caution due to the potential toxicity associated with brominated organic compounds. Proper safety protocols should be followed when working with it in a laboratory setting.
Formula:C18H12Br2
InChI:InChI=1S/C18H12Br2/c19-17-8-4-13(5-9-17)15-2-1-3-16(12-15)14-6-10-18(20)11-7-14/h1-12H
InChI key:XYRNOZKOAZFOOG-UHFFFAOYSA-N
SMILES:C1=CC(=CC(=C1)C2=CC=C(C=C2)Br)C3=CC=C(C=C3)Br
Found 5 products.