CAS 83909-35-7

methyl 5-amino-2-morpholin-4-ylbenzoate

Description:

Methyl 5-amino-2-morpholin-4-ylbenzoate, with the CAS number 83909-35-7, is a chemical compound characterized by its structural features that include a benzoate moiety, an amino group, and a morpholine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in polar solvents and potential biological activity due to the presence of the amino and morpholine functionalities. The morpholine ring contributes to its potential as a pharmacophore, making it of interest in medicinal chemistry for developing therapeutic agents. The presence of the amino group can facilitate hydrogen bonding, enhancing interactions with biological targets. Additionally, the methyl ester group may influence its lipophilicity and bioavailability. Overall, methyl 5-amino-2-morpholin-4-ylbenzoate is a compound that may possess diverse applications in pharmaceuticals and research, particularly in the development of new drugs or as a biochemical probe.

Formula: C₁₂H₁₆N₂O₃

InChI: InChI=1/C12H16N2O3/c1-16-12(15)10-8-9(13)2-3-11(10)14-4-6-17-7-5-14/h2-3,8H,4-7,13H2,1H3

SMILES: COC(=O)c1cc(ccc1N1CCOCC1)N

Synonyms:

• 5-Amino-2-morpholin-4-yl-benzoic acid methyl ester
• Benzoic Acid, 5-Amino-2-(4-Morpholinyl)-, Methyl Ester