CymitQuimica logo

CAS 83910-44-5

:

Ethyl 4-(methoxymethyl)-6-(phenylmethoxy)-9H-pyrido[3,4-b]indole-3-carboxylate

Description:
Ethyl 4-(methoxymethyl)-6-(phenylmethoxy)-9H-pyrido[3,4-b]indole-3-carboxylate, with the CAS number 83910-44-5, is a complex organic compound characterized by its unique structure that includes a pyridoindole framework. This compound features an ethyl ester functional group, which contributes to its solubility and reactivity. The presence of methoxymethyl and phenylmethoxy substituents enhances its potential for various chemical interactions, making it of interest in medicinal chemistry and drug development. The compound's structure suggests potential biological activity, possibly related to its ability to interact with biological targets due to the presence of the indole moiety, which is known for its role in various pharmacological activities. Additionally, the compound may exhibit properties such as lipophilicity, which can influence its absorption and distribution in biological systems. Overall, this substance represents a class of compounds that may have applications in therapeutic contexts, although specific biological activities and mechanisms would require further investigation.
Formula:C23H22N2O4
InChI:InChI=1S/C23H22N2O4/c1-3-28-23(26)22-18(14-27-2)21-17-11-16(29-13-15-7-5-4-6-8-15)9-10-19(17)25-20(21)12-24-22/h4-12,25H,3,13-14H2,1-2H3
InChI key:InChIKey=ALBKMJDFBZVHAK-UHFFFAOYSA-N
SMILES:C(OC)C1=C2C=3C(NC2=CN=C1C(OCC)=O)=CC=C(OCC4=CC=CC=C4)C3
Synonyms:
  • 9H-pyrido[3,4-b]indole-3-carboxylic acid, 4-(methoxymethyl)-6-(phenylmethoxy)-, ethyl ester
  • Ethyl 4-(methoxymethyl)-6-(phenylmethoxy)-9H-pyrido[3,4-b]indole-3-carboxylate
  • Zk 93423
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.