CAS 83912-90-7
:4-hydroxy-9-(3-hydroxy-4,5-dimethoxyphenyl)-4,4a,8,9-tetrahydro-1aH,7H-8,11a-(epiminomethano)[1,2,4]dithiazepino[4,3-b]oxireno[e][1,2]benzoxazine-7,13(12H)-dione
Description:
The chemical substance known as 4-hydroxy-9-(3-hydroxy-4,5-dimethoxyphenyl)-4,4a,8,9-tetrahydro-1aH,7H-8,11a-(epiminomethano)[1,2,4]dithiazepino[4,3-b]oxireno[e][1,2]benzoxazine-7,13(12H)-dione, with the CAS number 83912-90-7, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as hydroxyl (-OH) and methoxy (-OCH3) groups. This compound is part of a larger class of heterocyclic compounds, which often exhibit diverse biological activities. Its unique arrangement of atoms contributes to its potential pharmacological properties, making it of interest in medicinal chemistry. The presence of multiple rings and heteroatoms in its structure suggests that it may interact with biological systems in specific ways, potentially influencing its solubility, stability, and reactivity. Additionally, the compound's synthesis and characterization would require advanced techniques in organic chemistry, including spectroscopic methods for structural elucidation. Overall, this substance exemplifies the complexity and diversity found in organic compounds, particularly those with potential therapeutic applications.
Formula:C20H20N2O8S2
InChI:InChI=1/C20H20N2O8S2/c1-27-11-6-8(5-10(24)14(11)28-2)15-13-17(25)22-20(32-31-15,18(26)21-13)7-19-12(29-19)4-3-9(23)16(19)30-22/h3-6,9,12-13,15-16,23-24H,7H2,1-2H3,(H,21,26)
SMILES:COc1cc(cc(c1OC)O)C1C2C(=O)N3C(CC45C(C=CC(C4O3)O)O5)(C(=N2)O)SS1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Gliovirin
CAS:Gliovirin: a fungicide from T. harzianum, combats P. ultimum and T. brucei, inactive against various fungi/bacteria, reduces COX-2 and IL-2 expression.Formula:C20H20N2O8S2Color and Shape:SolidMolecular weight:480.51Gliovirin
CAS:GliovirinPurity:By hplc: 89.77% (Typical Value in Batch COA)Color and Shape: brownish powderMolecular weight:480.51g/molGliovirin
CAS:Gliovirin is a secondary metabolite produced by the fungus Gliocladium virens, which acts as a potent antifungal compound. Gliocladium virens, a soil-dwelling fungus, is the natural source from which Gliovirin is derived. This compound exhibits its antifungal properties by targeting and disrupting the structural integrity of fungal cell walls, thereby inhibiting their growth and proliferation.Formula:C20H20N2O8S2Purity:Min. 95%Molecular weight:480.5 g/mol




