CAS 83916-01-2
:(2S)-2-amino-N-[(1R,7S,12S,18R,21S)-21-amino-7,12-dibenzyl-22-(4-hydroxyphenyl)-1,18-dimethyl-2,5,8,11,14,17,20-heptaoxo-3,6,9,10,13,16,19-heptaazadocos-1-yl]-3-(4-hydroxyphenyl)propanamide (non-preferred name)
Description:
The chemical substance with the name "(2S)-2-amino-N-[(1R,7S,12S,18R,21S)-21-amino-7,12-dibenzyl-22-(4-hydroxyphenyl)-1,18-dimethyl-2,5,8,11,14,17,20-heptaoxo-3,6,9,10,13,16,19-heptaazadocos-1-yl]-3-(4-hydroxyphenyl)propanamide" and CAS number "83916-01-2" is a complex organic compound characterized by its multi-functional groups and stereochemistry. It features multiple chiral centers, indicating that it exists in specific stereoisomeric forms, which can significantly influence its biological activity and interactions. The presence of amino groups suggests potential for hydrogen bonding and reactivity, while the heptaoxo and heptaazadocos structures indicate a high degree of molecular complexity, likely contributing to its pharmacological properties. The hydroxyphenyl groups may enhance solubility and reactivity, making it suitable for various applications in medicinal chemistry. Overall, this compound's intricate structure and functional groups suggest it may play a role in therapeutic contexts, although specific biological activities would require further investigation.
Formula:C46H56N10O10
InChI:InChI=1/C46H56N10O10/c1-27(51-43(63)35(47)21-31-13-17-33(57)18-14-31)41(61)49-25-39(59)53-37(23-29-9-5-3-6-10-29)45(65)55-56-46(66)38(24-30-11-7-4-8-12-30)54-40(60)26-50-42(62)28(2)52-44(64)36(48)22-32-15-19-34(58)20-16-32/h3-20,27-28,35-38,57-58H,21-26,47-48H2,1-2H3,(H,49,61)(H,50,62)(H,51,63)(H,52,64)(H,53,59)(H,54,60)(H,55,65)(H,56,66)/t27-,28-,35+,36+,37+,38+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Biphalin
CAS:Biphalin: synthetic opioid, palindromic octapeptide, high analgesic effect, targets μ and δ receptors, less so κ.Formula:C46H56N10O10Purity:98%Color and Shape:SolidMolecular weight:909Biphalin trifluoroacetate salt (
CAS:Biphalin trifluoroacetate salt (H-Tyr-D-Ala-Gly-Phe-NH)2 trifluoroacetate salt is a peptide hormone. It has been shown to be an opioid that binds to the μ and δ opioid receptors and inhibits the production of inflammatory mediators. Biphalin trifluoroacetate salt (H-Tyr-D-Ala-Gly-Phe-NH)2 trifluoroacetate salt has also been shown to have neuroprotective effects. This drug has low potency and can only be used in vivo models. Biphalin trifluoroacetate salt (H-Tyr-D-Ala-Gly-Phe-NH)2 trifluoroacetate salt is not active against skin cancer cells, but does show activity against other types of cancer cells.Formula:C46H56N10O10Purity:Min. 95%Molecular weight:909 g/molRef: 3D-FB110181
Discontinued product

