CAS 83924-98-5

Flavidin

Description:

Flavidin, with the CAS number 83924-98-5, is a biotin-binding protein derived from the bacterium *Bacillus subtilis*. It is characterized by its high affinity for biotin, a vitamin that plays a crucial role in various metabolic processes, including fatty acid synthesis and amino acid metabolism. Flavidin exhibits a unique structure that allows it to bind biotin with remarkable specificity, making it a valuable tool in biochemical research and applications, such as affinity purification and detection assays. The protein is typically stable under a range of physiological conditions, which enhances its utility in laboratory settings. Additionally, Flavidin's ability to form complexes with biotin can be exploited in various biotechnological applications, including drug delivery systems and biosensors. Its properties, including solubility and stability, make it an interesting subject of study in protein chemistry and molecular biology. Overall, Flavidin serves as an important model for understanding protein-ligand interactions and has potential applications in both research and industry.

Formula: C₁₅H₁₂O₃

InChI: InChI=1S/C15H12O3/c16-11-3-8-1-2-9-4-12(17)6-13-15(9)14(8)10(5-11)7-18-13/h3-6,16-17H,1-2,7H2

InChI key: InChIKey=QMOLHJKSZMURCV-UHFFFAOYSA-N

SMILES: OC=1C=C2C=3C=4C(=CC(O)=CC4OC2)CCC3C1

Synonyms:

• 5H-Phenanthro(4,5-bcd)pyran-2,7-diol, 9,10-dihydro-
• 9,10-Dihydro-5H-phenanthro[4,5-bcd]pyran-2,7-diol
• Flavidin

Flavidin

CAS: 83924-98-5

Formula: C₁₅H₁₂O₃

Purity: 98.5%

Molecular weight: 240.2540

Ref: IN-DA00GQ9C

Flavidin

CAS: 83924-98-5

Flavidin has strong antioxidant ability, boosts fluorescent imaging for better cell labeling, and could improve molecular detection.

Formula: C₁₅H₁₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 240.25

Ref: TM-TN4062

Flavidin

CAS: 83924-98-5

Flavidin is a bioactive compound, which is an isolated metabolite often derived from microbial or plant sources with promising bioactive properties. It exhibits its potential benefits through its mode of action as an antimicrobial agent. This compound interferes with microbial cell wall synthesis or disrupts metabolic pathways, which can inhibit the growth of various microorganisms.

Formula: C₁₅H₁₂O₃

Purity: Min. 95%

Molecular weight: 240.25 g/mol

Ref: 3D-IDA92498