CymitQuimica logo

CAS 83933-16-8

:

4-methylthiophene-2-carboxamide

Description:
4-Methylthiophene-2-carboxamide is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. The presence of a methyl group at the 4-position and a carboxamide functional group at the 2-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the carboxamide group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals and agrochemicals, as compounds with thiophene moieties often display biological activity. Additionally, the presence of the carboxamide group may enhance its reactivity and interaction with biological targets. The compound's stability and reactivity can be influenced by factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, 4-methylthiophene-2-carboxamide is a versatile compound with potential utility in various chemical and biological contexts.
Formula:C6H7NOS
InChI:InChI=1/C6H7NOS/c1-4-2-5(6(7)8)9-3-4/h2-3H,1H3,(H2,7,8)
InChI key:KESQGXHWTOVOQT-UHFFFAOYSA-N
SMILES:Cc1cc(C(=O)N)sc1
Synonyms:
  • 2-Thiophenecarboxamide, 4-methyl-
Found 3 products.