
CAS 83948-37-2
:α-2-Propen-1-yl-2-furanmethanamine
Description:
α-2-Propen-1-yl-2-furanmethanamine, also known by its CAS number 83948-37-2, is an organic compound characterized by its unique structure that includes a furan ring and an allylic amine group. This compound typically exhibits properties associated with both furan derivatives and amines, such as potential reactivity in nucleophilic substitution and electrophilic addition reactions. The presence of the furan moiety contributes to its aromatic characteristics, which may influence its stability and reactivity. Additionally, the allylic position of the amine can provide sites for further chemical modifications. This compound may be of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential biological activity and utility as a building block in the synthesis of more complex molecules. However, specific physical properties such as boiling point, melting point, and solubility would need to be referenced from experimental data or literature for precise applications and handling guidelines.
Formula:C8H11NO
InChI:InChI=1S/C8H11NO/c1-2-4-7(9)8-5-3-6-10-8/h2-3,5-7H,1,4,9H2
InChI key:InChIKey=DITVBWXQRBAZMB-UHFFFAOYSA-N
SMILES:C(CC=C)(N)C1=CC=CO1
Synonyms:- 1-(Furan-2-yl)but-3-en-1-amine
- 2-Furanmethanamine, α-2-propenyl-
- α-2-Propen-1-yl-2-furanmethanamine
- 2-Furanmethanamine, α-2-propen-1-yl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.