CymitQuimica logo

CAS 83949-35-3

:

α-Cyclopropyl-3,4-dimethylbenzenemethanol

Description:
α-Cyclopropyl-3,4-dimethylbenzenemethanol is an organic compound characterized by its unique structure, which includes a cyclopropyl group and a benzyl alcohol moiety. The presence of the cyclopropyl ring contributes to its distinctive chemical properties, such as increased strain and reactivity compared to larger cyclic structures. The dimethyl substitutions on the benzene ring enhance its hydrophobic character and influence its interaction with biological systems. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of functional groups. Additionally, the compound's CAS number, 83949-35-3, allows for easy identification and reference in chemical databases. Overall, α-Cyclopropyl-3,4-dimethylbenzenemethanol represents a fascinating example of how structural variations can lead to diverse chemical behaviors and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C12H16O
InChI:InChI=1S/C12H16O/c1-8-3-4-11(7-9(8)2)12(13)10-5-6-10/h3-4,7,10,12-13H,5-6H2,1-2H3
InChI key:InChIKey=NSHXDLNNWOMQPK-UHFFFAOYSA-N
SMILES:C(O)(C1=CC(C)=C(C)C=C1)C2CC2
Synonyms:
  • α-Cyclopropyl-3,4-dimethylbenzenemethanol
  • Benzenemethanol, α-cyclopropyl-3,4-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.